C15H27N5O — CID 119393895
5-tert-butyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide (PubChem CID 119393895) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-tert-butyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119393895 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 5-tert-butyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)NCCCN2CCNCC2)n[nH]1 |
| InChI | InChI=1S/C15H27N5O/c1-15(2,3)13-11-12(18-19-13)14(21)17-5-4-8-20-9-6-16-7-10-20/h11,16H,4-10H2,1-3H3,(H,17,21)(H,18,19) |
| InChIKey | XZWBXKSXYIQABA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|