C14H26Cl2N4OS — CID 119393049
N-(3-piperazin-1-ylpropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119393049) has the molecular formula C14H26Cl2N4OS and a molecular weight of 369.36 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119393049 |
| Molecular Formula | C14H26Cl2N4OS |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC(C)c1nc(C(=O)NCCCN2CCNCC2)cs1.Cl.Cl |
| InChI | InChI=1S/C14H24N4OS.2ClH/c1-11(2)14-17-12(10-20-14)13(19)16-4-3-7-18-8-5-15-6-9-18;;/h10-11,15H,3-9H2,1-2H3,(H,16,19);2*1H |
| InChIKey | YOSYQGNDAXKSDO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|