C10H19Cl2N3OS — CID 119407394
N-(3-aminopropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119407394) has the molecular formula C10H19Cl2N3OS and a molecular weight of 300.26 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119407394 |
| Molecular Formula | C10H19Cl2N3OS |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-(3-aminopropyl)-2-propan-2-yl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CC(C)c1nc(C(=O)NCCCN)cs1.Cl.Cl |
| InChI | InChI=1S/C10H17N3OS.2ClH/c1-7(2)10-13-8(6-15-10)9(14)12-5-3-4-11;;/h6-7H,3-5,11H2,1-2H3,(H,12,14);2*1H |
| InChIKey | KWKZWYZFNNCAGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|