C12H20N2OS — CID 110694251
N-pentyl-2-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 110694251) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-pentyl-2-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-pentyl-2-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110694251 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-pentyl-2-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1csc(C(C)C)n1 |
| InChI | InChI=1S/C12H20N2OS/c1-4-5-6-7-13-11(15)10-8-16-12(14-10)9(2)3/h8-9H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | DRSSWUJFSBFMLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|