C16H22N2OS — CID 91833858
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 91833858) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91833858 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-2-propan-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)c1nc(C(=O)NCC[C@@H]2C[C@@H]3C=C[C@H]2C3)cs1 |
| InChI | InChI=1S/C16H22N2OS/c1-10(2)16-18-14(9-20-16)15(19)17-6-5-13-8-11-3-4-12(13)7-11/h3-4,9-13H,5-8H2,1-2H3,(H,17,19)/t11-,12+,13-/m1/s1 |
| InChIKey | RVXMTCWXPAZNPB-FRRDWIJNSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|