C9H12N4OS — CID 66374975
2-(1-aminoethyl)-N-(2-cyanoethyl)-1,3-thiazole-4-carboxamide (PubChem CID 66374975) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(2-cyanoethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(2-cyanoethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66374975 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-(1-aminoethyl)-N-(2-cyanoethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)NCCC#N)cs1 |
| InChI | InChI=1S/C9H12N4OS/c1-6(11)9-13-7(5-15-9)8(14)12-4-2-3-10/h5-6H,2,4,11H2,1H3,(H,12,14) |
| InChIKey | SNCWIHVOGCKWSP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|