C6H9N3O2S — CID 66389377
2-(1-aminoethyl)-N-hydroxy-1,3-thiazole-4-carboxamide (PubChem CID 66389377) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-hydroxy-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-hydroxy-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66389377 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(1-aminoethyl)-N-hydroxy-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)NO)cs1 |
| InChI | InChI=1S/C6H9N3O2S/c1-3(7)6-8-4(2-12-6)5(10)9-11/h2-3,11H,7H2,1H3,(H,9,10) |
| InChIKey | YFPWYTXXQMTNAO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|