C10H11N3OS2 — CID 66390934
2-(1-aminoethyl)-N-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 66390934) has the molecular formula C10H11N3OS2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66390934 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-(1-aminoethyl)-N-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2ccsc2)cs1 |
| InChI | InChI=1S/C10H11N3OS2/c1-6(11)10-13-8(5-16-10)9(14)12-7-2-3-15-4-7/h2-6H,11H2,1H3,(H,12,14) |
| InChIKey | KYFYYBVHVDNYGP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |