C12H12FN3O2S — CID 66390343
2-(1-aminoethyl)-N-(3-fluoro-4-hydroxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 66390343) has the molecular formula C12H12FN3O2S and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(3-fluoro-4-hydroxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(3-fluoro-4-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66390343 |
| Molecular Formula | C12H12FN3O2S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-(1-aminoethyl)-N-(3-fluoro-4-hydroxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2ccc(O)c(F)c2)cs1 |
| InChI | InChI=1S/C12H12FN3O2S/c1-6(14)12-16-9(5-19-12)11(18)15-7-2-3-10(17)8(13)4-7/h2-6,17H,14H2,1H3,(H,15,18) |
| InChIKey | MCNJWSFNWMBJJV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|