C14H14N4OS — CID 66389323
2-(1-aminoethyl)-N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 66389323) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminoethyl)-N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66389323 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(1-aminoethyl)-N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(N)c1nc(C(=O)Nc2ccc3[nH]ccc3c2)cs1 |
| InChI | InChI=1S/C14H14N4OS/c1-8(15)14-18-12(7-20-14)13(19)17-10-2-3-11-9(6-10)4-5-16-11/h2-8,16H,15H2,1H3,(H,17,19) |
| InChIKey | UPKGMVSRJSABEK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |