C12H9N3OS — CID 63050132
N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 63050132) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63050132 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(1H-indol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ccc2c1)c1cscn1 |
| InChI | InChI=1S/C12H9N3OS/c16-12(11-6-17-7-14-11)15-9-1-2-10-8(5-9)3-4-13-10/h1-7,13H,(H,15,16) |
| InChIKey | AQIHNCUFENCWPD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |