C10H6F2N2OS — CID 62045147
N-(3,4-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62045147) has the molecular formula C10H6F2N2OS and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62045147 |
| Molecular Formula | C10H6F2N2OS |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1cscn1 |
| InChI | InChI=1S/C10H6F2N2OS/c11-7-2-1-6(3-8(7)12)14-10(15)9-4-16-5-13-9/h1-5H,(H,14,15) |
| InChIKey | YBKQUHGQAWTTHL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |