C15H10Cl2N2O — CID 171571914
2,4-dichloro-N-(1H-indol-5-yl)benzamide (PubChem CID 171571914) has the molecular formula C15H10Cl2N2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 2,4-dichloro-N-(1H-indol-5-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(1H-indol-5-yl)benzamide |
|---|---|
| PubChem CID | 171571914 |
| Molecular Formula | C15H10Cl2N2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2,4-dichloro-N-(1H-indol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2[nH]ccc2c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N2O/c16-10-1-3-12(13(17)8-10)15(20)19-11-2-4-14-9(7-11)5-6-18-14/h1-8,18H,(H,19,20) |
| InChIKey | UKNXQYWCFRGMAB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |