C15H10F2N2O — CID 63718780
N-(3,4-difluorophenyl)-1H-indole-5-carboxamide (PubChem CID 63718780) has the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1H-indole-5-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 63718780 |
| Molecular Formula | C15H10F2N2O |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(3,4-difluorophenyl)-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H10F2N2O/c16-12-3-2-11(8-13(12)17)19-15(20)10-1-4-14-9(7-10)5-6-18-14/h1-8,18H,(H,19,20) |
| InChIKey | RGSZHUXDBOHTNC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |