C18H16N2O3 — CID 75495645
3-[4-(1H-indole-5-carbonylamino)phenyl]propanoic acid (PubChem CID 75495645) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-[4-(1H-indole-5-carbonylamino)phenyl]propanoic acid.
| Compound Name | 3-[4-(1H-indole-5-carbonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 75495645 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[4-(1H-indole-5-carbonylamino)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)c2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C18H16N2O3/c21-17(22)8-3-12-1-5-15(6-2-12)20-18(23)14-4-7-16-13(11-14)9-10-19-16/h1-2,4-7,9-11,19H,3,8H2,(H,20,23)(H,21,22) |
| InChIKey | NPWRDINYGUJEEO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |