C17H14N2O3 — CID 141342691
4-[(1H-indole-5-carbonylamino)methyl]benzoic acid (PubChem CID 141342691) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[(1H-indole-5-carbonylamino)methyl]benzoic acid.
| Compound Name | 4-[(1H-indole-5-carbonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 141342691 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[(1H-indole-5-carbonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C17H14N2O3/c20-16(14-5-6-15-13(9-14)7-8-18-15)19-10-11-1-3-12(4-2-11)17(21)22/h1-9,18H,10H2,(H,19,20)(H,21,22) |
| InChIKey | VKEKDAUHQIKTSK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |