C18H15N3O3 — CID 59802724
N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1H-indole-5-carboxamide (PubChem CID 59802724) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1H-indole-5-carboxamide.
| Compound Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 59802724 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-1H-indole-5-carboxamide |
| SMILES | O=C1COc2ccc(CNC(=O)c3ccc4[nH]ccc4c3)cc2N1 |
| InChI | InChI=1S/C18H15N3O3/c22-17-10-24-16-4-1-11(7-15(16)21-17)9-20-18(23)13-2-3-14-12(8-13)5-6-19-14/h1-8,19H,9-10H2,(H,20,23)(H,21,22) |
| InChIKey | CJUVIEVHAKJUEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |