C19H16N4O3 — CID 59802661
N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-(1H-pyrazol-5-yl)benzamide (PubChem CID 59802661) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-(1H-pyrazol-5-yl)benzamide.
| Compound Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59802661 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-3-(1H-pyrazol-5-yl)benzamide |
| SMILES | O=C1COc2ccc(CNC(=O)c3cccc(-c4ccn[nH]4)c3)cc2N1 |
| InChI | InChI=1S/C19H16N4O3/c24-18-11-26-17-5-4-12(8-16(17)22-18)10-20-19(25)14-3-1-2-13(9-14)15-6-7-21-23-15/h1-9H,10-11H2,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | AIUIQWPOFNCGBU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |