C16H15N3O3 — CID 110789922
N-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]pyridine-3-carboxamide (PubChem CID 110789922) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110789922 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C1COc2ccc(CCNC(=O)c3cccnc3)cc2N1 |
| InChI | InChI=1S/C16H15N3O3/c20-15-10-22-14-4-3-11(8-13(14)19-15)5-7-18-16(21)12-2-1-6-17-9-12/h1-4,6,8-9H,5,7,10H2,(H,18,21)(H,19,20) |
| InChIKey | IYHZYIIRPJRYHE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |