C16H14N4O3 — CID 9211562
N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]pyridine-3-carboxamide (PubChem CID 9211562) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9211562 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]pyridine-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cccnc1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H14N4O3/c1-10(19-20-16(22)12-3-2-6-17-8-12)11-4-5-14-13(7-11)18-15(21)9-23-14/h2-8H,9H2,1H3,(H,18,21)(H,20,22)/b19-10- |
| InChIKey | VYKRODNRRSOYOI-GRSHGNNSSA-N |
| XLogP | 1.57 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|