C21H16FN3O3S — CID 9298327
5-(4-fluorophenyl)-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]thiophene-2-carboxamide (PubChem CID 9298327) has the molecular formula C21H16FN3O3S and a molecular weight of 409.44 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]thiophene-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9298327 |
| Molecular Formula | C21H16FN3O3S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]thiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(-c2ccc(F)cc2)s1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C21H16FN3O3S/c1-12(14-4-7-17-16(10-14)23-20(26)11-28-17)24-25-21(27)19-9-8-18(29-19)13-2-5-15(22)6-3-13/h2-10H,11H2,1H3,(H,23,26)(H,25,27)/b24-12- |
| InChIKey | QPZAMOPYMANYSI-MSXFZWOLSA-N |
| XLogP | 4.04 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|