C17H13Cl2N3O3 — CID 9233411
2,5-dichloro-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]benzamide (PubChem CID 9233411) has the molecular formula C17H13Cl2N3O3 and a molecular weight of 378.22 g/mol. Its IUPAC name is 2,5-dichloro-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]benzamide.
| Compound Name | 2,5-dichloro-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 9233411 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2,5-dichloro-N-[(Z)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1cc(Cl)ccc1Cl)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-9(10-2-5-15-14(6-10)20-16(23)8-25-15)21-22-17(24)12-7-11(18)3-4-13(12)19/h2-7H,8H2,1H3,(H,20,23)(H,22,24)/b21-9- |
| InChIKey | IXVJRQICZMVSML-NKVSQWTQSA-N |
| XLogP | 3.48 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|