C17H16ClN3O2 — CID 9211607
6-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 9211607) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 6-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 9211607 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-[(Z)-N-(3-chloro-4-methylanilino)-C-methylcarbonimidoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | C/C(=N/Nc1ccc(C)c(Cl)c1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C17H16ClN3O2/c1-10-3-5-13(8-14(10)18)21-20-11(2)12-4-6-16-15(7-12)19-17(22)9-23-16/h3-8,21H,9H2,1-2H3,(H,19,22)/b20-11- |
| InChIKey | HGMMQZMNSISCHD-JAIQZWGSSA-N |
| XLogP | 3.82 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|