C18H14N4O3 — CID 59802654
N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]quinoxaline-6-carboxamide (PubChem CID 59802654) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]quinoxaline-6-carboxamide.
| Compound Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 59802654 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]quinoxaline-6-carboxamide |
| SMILES | O=C1COc2ccc(CNC(=O)c3ccc4nccnc4c3)cc2N1 |
| InChI | InChI=1S/C18H14N4O3/c23-17-10-25-16-4-1-11(7-15(16)22-17)9-21-18(24)12-2-3-13-14(8-12)20-6-5-19-13/h1-8H,9-10H2,(H,21,24)(H,22,23) |
| InChIKey | NWCVSEHSCHPUPS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |