C18H14N4O3 — CID 59802884
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(1H-pyrazol-5-yl)benzamide (PubChem CID 59802884) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(1H-pyrazol-5-yl)benzamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59802884 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(1H-pyrazol-5-yl)benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cccc(-c4ccn[nH]4)c3)cc2N1 |
| InChI | InChI=1S/C18H14N4O3/c23-17-10-25-16-5-4-13(9-15(16)21-17)20-18(24)12-3-1-2-11(8-12)14-6-7-19-22-14/h1-9H,10H2,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | YQBVXWDKYJZKJT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |