C20H20N2O5 — CID 42939881
N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(oxolan-2-ylmethoxy)benzamide (PubChem CID 42939881) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 42939881 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-6-yl)-3-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C1COc2ccc(NC(=O)c3cccc(OCC4CCCO4)c3)cc2N1 |
| InChI | InChI=1S/C20H20N2O5/c23-19-12-27-18-7-6-14(10-17(18)22-19)21-20(24)13-3-1-4-15(9-13)26-11-16-5-2-8-25-16/h1,3-4,6-7,9-10,16H,2,5,8,11-12H2,(H,21,24)(H,22,23) |
| InChIKey | BHRYHFXUYNBFFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |