C19H18N2O4 — CID 139632495
4-[2-(1H-indole-5-carbonylamino)phenoxy]butanoic acid (PubChem CID 139632495) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[2-(1H-indole-5-carbonylamino)phenoxy]butanoic acid.
| Compound Name | 4-[2-(1H-indole-5-carbonylamino)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 139632495 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[2-(1H-indole-5-carbonylamino)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccccc1NC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H18N2O4/c22-18(23)6-3-11-25-17-5-2-1-4-16(17)21-19(24)14-7-8-15-13(12-14)9-10-20-15/h1-2,4-5,7-10,12,20H,3,6,11H2,(H,21,24)(H,22,23) |
| InChIKey | CIPWLIKYUHNTBC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|