C21H20N2O6 — CID 139670856
1-[2-[2-(3-carboxypropoxy)anilino]-2-oxoethyl]indole-5-carboxylic acid (PubChem CID 139670856) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 1-[2-[2-(3-carboxypropoxy)anilino]-2-oxoethyl]indole-5-carboxylic acid.
| Compound Name | 1-[2-[2-(3-carboxypropoxy)anilino]-2-oxoethyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 139670856 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[2-[2-(3-carboxypropoxy)anilino]-2-oxoethyl]indole-5-carboxylic acid |
| SMILES | O=C(O)CCCOc1ccccc1NC(=O)Cn1ccc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C21H20N2O6/c24-19(13-23-10-9-14-12-15(21(27)28)7-8-17(14)23)22-16-4-1-2-5-18(16)29-11-3-6-20(25)26/h1-2,4-5,7-10,12H,3,6,11,13H2,(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | AJUCDUPZHJEDLN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|