C29H36N2O4 — CID 54354817
4-[2-[3-[1-(2,4-dimethylpentan-3-yl)indol-5-yl]but-2-enoylamino]phenoxy]butanoic acid (PubChem CID 54354817) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[2-[3-[1-(2,4-dimethylpentan-3-yl)indol-5-yl]but-2-enoylamino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[3-[1-(2,4-dimethylpentan-3-yl)indol-5-yl]but-2-enoylamino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 54354817 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 4-[2-[3-[1-(2,4-dimethylpentan-3-yl)indol-5-yl]but-2-enoylamino]phenoxy]butanoic acid |
| SMILES | CC(=CC(=O)Nc1ccccc1OCCCC(=O)O)c1ccc2c(ccn2C(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C29H36N2O4/c1-19(2)29(20(3)4)31-15-14-23-18-22(12-13-25(23)31)21(5)17-27(32)30-24-9-6-7-10-26(24)35-16-8-11-28(33)34/h6-7,9-10,12-15,17-20,29H,8,11,16H2,1-5H3,(H,30,32)(H,33,34) |
| InChIKey | UIJPFPOXHOLJFH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|