C37H34F2N2O4 — CID 10258151
ethyl 4-[2-[[(E)-3-[1-[bis(4-fluorophenyl)methyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate (PubChem CID 10258151) has the molecular formula C37H34F2N2O4 and a molecular weight of 608.69 g/mol. Its IUPAC name is ethyl 4-[2-[[(E)-3-[1-[bis(4-fluorophenyl)methyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[[(E)-3-[1-[bis(4-fluorophenyl)methyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 10258151 |
| Molecular Formula | C37H34F2N2O4 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | ethyl 4-[2-[[(E)-3-[1-[bis(4-fluorophenyl)methyl]indol-5-yl]but-2-enoyl]amino]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1NC(=O)/C=C(\C)c1ccc2c(ccn2C(c2ccc(F)cc2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C37H34F2N2O4/c1-3-44-36(43)9-6-22-45-34-8-5-4-7-32(34)40-35(42)23-25(2)28-14-19-33-29(24-28)20-21-41(33)37(26-10-15-30(38)16-11-26)27-12-17-31(39)18-13-27/h4-5,7-8,10-21,23-24,37H,3,6,9,22H2,1-2H3,(H,40,42)/b25-23+ |
| InChIKey | LTWZEWINLHXHQF-WJTDDFOZSA-N |
| XLogP | 8.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|