C25H31NO4 — CID 14476002
4-[2-[[(E)-3-(4-pentylphenyl)but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 14476002) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(4-pentylphenyl)but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-(4-pentylphenyl)but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 14476002 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 4-[2-[[(E)-3-(4-pentylphenyl)but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCCCc1ccc(/C(C)=C/C(=O)Nc2ccccc2OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-3-4-5-9-20-13-15-21(16-14-20)19(2)18-24(27)26-22-10-6-7-11-23(22)30-17-8-12-25(28)29/h6-7,10-11,13-16,18H,3-5,8-9,12,17H2,1-2H3,(H,26,27)(H,28,29)/b19-18+ |
| InChIKey | MXPPNRHQJJTJPN-VHEBQXMUSA-N |
| XLogP | 5.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|