C29H35FN2O4 — CID 67753823
4-[5-fluoro-2-[[(E)-3-(1-heptan-4-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 67753823) has the molecular formula C29H35FN2O4 and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[5-fluoro-2-[[(E)-3-(1-heptan-4-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[5-fluoro-2-[[(E)-3-(1-heptan-4-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67753823 |
| Molecular Formula | C29H35FN2O4 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-[5-fluoro-2-[[(E)-3-(1-heptan-4-ylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCC(CCC)n1ccc2cc(/C(C)=C/C(=O)Nc3ccc(F)cc3OCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C29H35FN2O4/c1-4-7-24(8-5-2)32-15-14-22-18-21(10-13-26(22)32)20(3)17-28(33)31-25-12-11-23(30)19-27(25)36-16-6-9-29(34)35/h10-15,17-19,24H,4-9,16H2,1-3H3,(H,31,33)(H,34,35)/b20-17+ |
| InChIKey | HVZOGSOFYVBKBB-LVZFUZTISA-N |
| XLogP | 7.21 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|