C26H33NO4 — CID 14476004
4-[2-[[(E)-3-[4-(2-ethylbutyl)phenyl]but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 14476004) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 4-[2-[[(E)-3-[4-(2-ethylbutyl)phenyl]but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-[4-(2-ethylbutyl)phenyl]but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 14476004 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[2-[[(E)-3-[4-(2-ethylbutyl)phenyl]but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCC(CC)Cc1ccc(/C(C)=C/C(=O)Nc2ccccc2OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-4-20(5-2)18-21-12-14-22(15-13-21)19(3)17-25(28)27-23-9-6-7-10-24(23)31-16-8-11-26(29)30/h6-7,9-10,12-15,17,20H,4-5,8,11,16,18H2,1-3H3,(H,27,28)(H,29,30)/b19-17+ |
| InChIKey | APBAUTUFZHPRMW-HTXNQAPBSA-N |
| XLogP | 5.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|