C34H35NO5 — CID 23045919
4-[2-[[4-[bis(4-ethylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid (PubChem CID 23045919) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is 4-[2-[[4-[bis(4-ethylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-[bis(4-ethylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 23045919 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 4-[2-[[4-[bis(4-ethylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid |
| SMILES | CCc1ccc(C(Oc2ccc(C(=O)Nc3ccccc3OCCCC(=O)O)cc2)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C34H35NO5/c1-3-24-11-15-26(16-12-24)33(27-17-13-25(4-2)14-18-27)40-29-21-19-28(20-22-29)34(38)35-30-8-5-6-9-31(30)39-23-7-10-32(36)37/h5-6,8-9,11-22,33H,3-4,7,10,23H2,1-2H3,(H,35,38)(H,36,37) |
| InChIKey | LODNETACRMTJFD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|