C29H33NO5 — CID 139610059
4-[2-[[4-[1-(4-ethylphenyl)ethoxy]-2,3-dimethylphenyl]carbamoyl]phenoxy]butanoic acid (PubChem CID 139610059) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[2-[[4-[1-(4-ethylphenyl)ethoxy]-2,3-dimethylphenyl]carbamoyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-[1-(4-ethylphenyl)ethoxy]-2,3-dimethylphenyl]carbamoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 139610059 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 4-[2-[[4-[1-(4-ethylphenyl)ethoxy]-2,3-dimethylphenyl]carbamoyl]phenoxy]butanoic acid |
| SMILES | CCc1ccc(C(C)Oc2ccc(NC(=O)c3ccccc3OCCCC(=O)O)c(C)c2C)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-5-22-12-14-23(15-13-22)21(4)35-26-17-16-25(19(2)20(26)3)30-29(33)24-9-6-7-10-27(24)34-18-8-11-28(31)32/h6-7,9-10,12-17,21H,5,8,11,18H2,1-4H3,(H,30,33)(H,31,32) |
| InChIKey | CQUMCOSMQMUTCH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|