C33H41NO5 — CID 139610077
ethyl 4-[2-[[3,5-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate (PubChem CID 139610077) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is ethyl 4-[2-[[3,5-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[[3,5-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 139610077 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | ethyl 4-[2-[[3,5-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1C(=O)Nc1cc(C)c(OC(C)c2ccc(CC(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C33H41NO5/c1-7-37-31(35)13-10-18-38-30-12-9-8-11-29(30)33(36)34-28-20-23(4)32(24(5)21-28)39-25(6)27-16-14-26(15-17-27)19-22(2)3/h8-9,11-12,14-17,20-22,25H,7,10,13,18-19H2,1-6H3,(H,34,36) |
| InChIKey | IDGQRBZHAFUQDT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|