C32H39NO5 — CID 139610124
4-[2-[[4-[[3,4-bis(2-methylpropyl)phenyl]methoxy]phenyl]carbamoyl]phenoxy]butanoic acid (PubChem CID 139610124) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is 4-[2-[[4-[[3,4-bis(2-methylpropyl)phenyl]methoxy]phenyl]carbamoyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-[[3,4-bis(2-methylpropyl)phenyl]methoxy]phenyl]carbamoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 139610124 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 4-[2-[[4-[[3,4-bis(2-methylpropyl)phenyl]methoxy]phenyl]carbamoyl]phenoxy]butanoic acid |
| SMILES | CC(C)Cc1ccc(COc2ccc(NC(=O)c3ccccc3OCCCC(=O)O)cc2)cc1CC(C)C |
| InChI | InChI=1S/C32H39NO5/c1-22(2)18-25-12-11-24(20-26(25)19-23(3)4)21-38-28-15-13-27(14-16-28)33-32(36)29-8-5-6-9-30(29)37-17-7-10-31(34)35/h5-6,8-9,11-16,20,22-23H,7,10,17-19,21H2,1-4H3,(H,33,36)(H,34,35) |
| InChIKey | KNFOMSXYRLPWQL-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|