C30H35NO5 — CID 139610029
4-[2-[[2,3-dimethyl-4-[1-(4-propan-2-ylphenyl)ethoxy]phenyl]carbamoyl]phenoxy]butanoic acid (PubChem CID 139610029) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is 4-[2-[[2,3-dimethyl-4-[1-(4-propan-2-ylphenyl)ethoxy]phenyl]carbamoyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[2,3-dimethyl-4-[1-(4-propan-2-ylphenyl)ethoxy]phenyl]carbamoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 139610029 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 4-[2-[[2,3-dimethyl-4-[1-(4-propan-2-ylphenyl)ethoxy]phenyl]carbamoyl]phenoxy]butanoic acid |
| SMILES | Cc1c(NC(=O)c2ccccc2OCCCC(=O)O)ccc(OC(C)c2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C30H35NO5/c1-19(2)23-12-14-24(15-13-23)22(5)36-27-17-16-26(20(3)21(27)4)31-30(34)25-9-6-7-10-28(25)35-18-8-11-29(32)33/h6-7,9-10,12-17,19,22H,8,11,18H2,1-5H3,(H,31,34)(H,32,33) |
| InChIKey | NHQQANQTZCGCHK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|