C29H33NO5 — CID 14695014
4-[2-[[2,3-dimethyl-4-[(4-propylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid (PubChem CID 14695014) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[2-[[2,3-dimethyl-4-[(4-propylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[2,3-dimethyl-4-[(4-propylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 14695014 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 4-[2-[[2,3-dimethyl-4-[(4-propylphenyl)methoxy]benzoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCc1ccc(COc2ccc(C(=O)Nc3ccccc3OCCCC(=O)O)c(C)c2C)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-4-8-22-12-14-23(15-13-22)19-35-26-17-16-24(20(2)21(26)3)29(33)30-25-9-5-6-10-27(25)34-18-7-11-28(31)32/h5-6,9-10,12-17H,4,7-8,11,18-19H2,1-3H3,(H,30,33)(H,31,32) |
| InChIKey | LDYXLXHJGHDIJY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|