C40H48N2O4 — CID 23045896
4-[2-[[4-[bis[[4-(2-methylpropyl)phenyl]methyl]amino]-2-methylbenzoyl]amino]phenoxy]butanoic acid (PubChem CID 23045896) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is 4-[2-[[4-[bis[[4-(2-methylpropyl)phenyl]methyl]amino]-2-methylbenzoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-[bis[[4-(2-methylpropyl)phenyl]methyl]amino]-2-methylbenzoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 23045896 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 4-[2-[[4-[bis[[4-(2-methylpropyl)phenyl]methyl]amino]-2-methylbenzoyl]amino]phenoxy]butanoic acid |
| SMILES | Cc1cc(N(Cc2ccc(CC(C)C)cc2)Cc2ccc(CC(C)C)cc2)ccc1C(=O)Nc1ccccc1OCCCC(=O)O |
| InChI | InChI=1S/C40H48N2O4/c1-28(2)23-31-12-16-33(17-13-31)26-42(27-34-18-14-32(15-19-34)24-29(3)4)35-20-21-36(30(5)25-35)40(45)41-37-9-6-7-10-38(37)46-22-8-11-39(43)44/h6-7,9-10,12-21,25,28-29H,8,11,22-24,26-27H2,1-5H3,(H,41,45)(H,43,44) |
| InChIKey | BJWHBRIFCJWTDX-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|