C31H35NO5 — CID 14695048
4-[2-[[7-[[4-(2-methylpropyl)phenyl]methoxy]-2,3-dihydro-1H-indene-4-carbonyl]amino]phenoxy]butanoic acid (PubChem CID 14695048) has the molecular formula C31H35NO5 and a molecular weight of 501.62 g/mol. Its IUPAC name is 4-[2-[[7-[[4-(2-methylpropyl)phenyl]methoxy]-2,3-dihydro-1H-indene-4-carbonyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[7-[[4-(2-methylpropyl)phenyl]methoxy]-2,3-dihydro-1H-indene-4-carbonyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 14695048 |
| Molecular Formula | C31H35NO5 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[2-[[7-[[4-(2-methylpropyl)phenyl]methoxy]-2,3-dihydro-1H-indene-4-carbonyl]amino]phenoxy]butanoic acid |
| SMILES | CC(C)Cc1ccc(COc2ccc(C(=O)Nc3ccccc3OCCCC(=O)O)c3c2CCC3)cc1 |
| InChI | InChI=1S/C31H35NO5/c1-21(2)19-22-12-14-23(15-13-22)20-37-28-17-16-26(24-7-5-8-25(24)28)31(35)32-27-9-3-4-10-29(27)36-18-6-11-30(33)34/h3-4,9-10,12-17,21H,5-8,11,18-20H2,1-2H3,(H,32,35)(H,33,34) |
| InChIKey | WVWGTVATKZCDTD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|