C20H22N2O6 — CID 54091213
ethyl 4-[2-[(2-methyl-4-nitrobenzoyl)amino]phenoxy]butanoate (PubChem CID 54091213) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl 4-[2-[(2-methyl-4-nitrobenzoyl)amino]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[(2-methyl-4-nitrobenzoyl)amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 54091213 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 4-[2-[(2-methyl-4-nitrobenzoyl)amino]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C20H22N2O6/c1-3-27-19(23)9-6-12-28-18-8-5-4-7-17(18)21-20(24)16-11-10-15(22(25)26)13-14(16)2/h4-5,7-8,10-11,13H,3,6,9,12H2,1-2H3,(H,21,24) |
| InChIKey | MTZNYMAXBSEDKX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|