C19H20N2O6 — CID 89048060
ethyl 4-(2-benzamido-5-nitrophenoxy)butanoate (PubChem CID 89048060) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is ethyl 4-(2-benzamido-5-nitrophenoxy)butanoate.
| Compound Name | ethyl 4-(2-benzamido-5-nitrophenoxy)butanoate |
|---|---|
| PubChem CID | 89048060 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | ethyl 4-(2-benzamido-5-nitrophenoxy)butanoate |
| SMILES | CCOC(=O)CCCOc1cc([N+](=O)[O-])ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O6/c1-2-26-18(22)9-6-12-27-17-13-15(21(24)25)10-11-16(17)20-19(23)14-7-4-3-5-8-14/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3,(H,20,23) |
| InChIKey | YXXJZRXIFMBLGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|