C14H19NO7 — CID 59442402
ethyl 4-(2,3-dimethoxy-5-nitrophenoxy)butanoate (PubChem CID 59442402) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl 4-(2,3-dimethoxy-5-nitrophenoxy)butanoate.
| Compound Name | ethyl 4-(2,3-dimethoxy-5-nitrophenoxy)butanoate |
|---|---|
| PubChem CID | 59442402 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | ethyl 4-(2,3-dimethoxy-5-nitrophenoxy)butanoate |
| SMILES | CCOC(=O)CCCOc1cc([N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C14H19NO7/c1-4-21-13(16)6-5-7-22-12-9-10(15(17)18)8-11(19-2)14(12)20-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | YQKMHDHAWVODMY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|