C26H34O8S2 — CID 54546793
ethyl 4-[2,6-dimethoxy-4-[(2R,4R)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]butanoate (PubChem CID 54546793) has the molecular formula C26H34O8S2 and a molecular weight of 538.68 g/mol. Its IUPAC name is ethyl 4-[2,6-dimethoxy-4-[(2R,4R)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2,6-dimethoxy-4-[(2R,4R)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 54546793 |
| Molecular Formula | C26H34O8S2 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | ethyl 4-[2,6-dimethoxy-4-[(2R,4R)-2-(3,4,5-trimethoxyphenyl)-1,3-dithiolan-4-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1c(OC)cc([C@@H]2CS[C@@H](c3cc(OC)c(OC)c(OC)c3)S2)cc1OC |
| InChI | InChI=1S/C26H34O8S2/c1-7-33-23(27)9-8-10-34-25-20(30-4)11-16(12-21(25)31-5)22-15-35-26(36-22)17-13-18(28-2)24(32-6)19(14-17)29-3/h11-14,22,26H,7-10,15H2,1-6H3/t22-,26+/m0/s1 |
| InChIKey | ZHBUIWDMEACKEH-BKMJKUGQSA-N |
| XLogP | 5.67 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|