C16H23NO6 — CID 8529703
ethyl 4-oxo-4-[(3,4,5-trimethoxyphenyl)methylamino]butanoate (PubChem CID 8529703) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl 4-oxo-4-[(3,4,5-trimethoxyphenyl)methylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[(3,4,5-trimethoxyphenyl)methylamino]butanoate |
|---|---|
| PubChem CID | 8529703 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 4-oxo-4-[(3,4,5-trimethoxyphenyl)methylamino]butanoate |
| SMILES | CCOC(=O)CCC(=O)NCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H23NO6/c1-5-23-15(19)7-6-14(18)17-10-11-8-12(20-2)16(22-4)13(9-11)21-3/h8-9H,5-7,10H2,1-4H3,(H,17,18) |
| InChIKey | BIRNLOGNZYECGZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |