C15H22ClNO4 — CID 64579502
ethyl 4-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butanoate (PubChem CID 64579502) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is ethyl 4-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butanoate.
| Compound Name | ethyl 4-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butanoate |
|---|---|
| PubChem CID | 64579502 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | ethyl 4-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butanoate |
| SMILES | CCOC(=O)CCCNCc1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22ClNO4/c1-4-21-14(18)6-5-7-17-10-11-8-12(16)15(20-3)13(9-11)19-2/h8-9,17H,4-7,10H2,1-3H3 |
| InChIKey | YQSKNPGQLYQYBG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|