C14H21ClN2O3 — CID 43221381
2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-propylacetamide (PubChem CID 43221381) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-propylacetamide.
| Compound Name | 2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 43221381 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNCc1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21ClN2O3/c1-4-5-17-13(18)9-16-8-10-6-11(15)14(20-3)12(7-10)19-2/h6-7,16H,4-5,8-9H2,1-3H3,(H,17,18) |
| InChIKey | IROHWIPFMIRVHS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |