C15H21ClN2O3 — CID 78978873
3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-cyclopropylpropanamide (PubChem CID 78978873) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 78978873 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-N-cyclopropylpropanamide |
| SMILES | COc1cc(CNCCC(=O)NC2CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H21ClN2O3/c1-20-13-8-10(7-12(16)15(13)21-2)9-17-6-5-14(19)18-11-3-4-11/h7-8,11,17H,3-6,9H2,1-2H3,(H,18,19) |
| InChIKey | RUNQIBGVMUVXDC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|