C16H25BrN2O3 — CID 119764855
7-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]heptanamide (PubChem CID 119764855) has the molecular formula C16H25BrN2O3 and a molecular weight of 373.29 g/mol. Its IUPAC name is 7-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]heptanamide.
| Compound Name | 7-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]heptanamide |
|---|---|
| PubChem CID | 119764855 |
| Molecular Formula | C16H25BrN2O3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 7-amino-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]heptanamide |
| SMILES | COc1cc(CNC(=O)CCCCCCN)cc(Br)c1OC |
| InChI | InChI=1S/C16H25BrN2O3/c1-21-14-10-12(9-13(17)16(14)22-2)11-19-15(20)7-5-3-4-6-8-18/h9-10H,3-8,11,18H2,1-2H3,(H,19,20) |
| InChIKey | KMEAQSLKEFZFIE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|